C27H40N2O3 — CID 10310334
N-[4-[(3-ethylphenyl)methylamino]-1-(4-hexoxyphenyl)-3-hydroxybutan-2-yl]acetamide (PubChem CID 10310334) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is N-[4-[(3-ethylphenyl)methylamino]-1-(4-hexoxyphenyl)-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[4-[(3-ethylphenyl)methylamino]-1-(4-hexoxyphenyl)-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 10310334 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | N-[4-[(3-ethylphenyl)methylamino]-1-(4-hexoxyphenyl)-3-hydroxybutan-2-yl]acetamide |
| SMILES | CCCCCCOc1ccc(CC(NC(C)=O)C(O)CNCc2cccc(CC)c2)cc1 |
| InChI | InChI=1S/C27H40N2O3/c1-4-6-7-8-16-32-25-14-12-23(13-15-25)18-26(29-21(3)30)27(31)20-28-19-24-11-9-10-22(5-2)17-24/h9-15,17,26-28,31H,4-8,16,18-20H2,1-3H3,(H,29,30) |
| InChIKey | QUQXQDJSZMSPGB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|