C27H40N2O3 — CID 69322754
N-[(2S,3R)-4-[(3-ethylphenyl)methylamino]-1-(2-hexoxyphenyl)-3-hydroxybutan-2-yl]acetamide (PubChem CID 69322754) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is N-[(2S,3R)-4-[(3-ethylphenyl)methylamino]-1-(2-hexoxyphenyl)-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-4-[(3-ethylphenyl)methylamino]-1-(2-hexoxyphenyl)-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 69322754 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | N-[(2S,3R)-4-[(3-ethylphenyl)methylamino]-1-(2-hexoxyphenyl)-3-hydroxybutan-2-yl]acetamide |
| SMILES | CCCCCCOc1ccccc1C[C@H](NC(C)=O)[C@H](O)CNCc1cccc(CC)c1 |
| InChI | InChI=1S/C27H40N2O3/c1-4-6-7-10-16-32-27-15-9-8-14-24(27)18-25(29-21(3)30)26(31)20-28-19-23-13-11-12-22(5-2)17-23/h8-9,11-15,17,25-26,28,31H,4-7,10,16,18-20H2,1-3H3,(H,29,30)/t25-,26+/m0/s1 |
| InChIKey | CALHCSHWYBODIE-IZZNHLLZSA-N |
| XLogP | 4.41 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|