C23H34N2O2 — CID 59021873
(2R,3S)-3-amino-4-(3-butoxyphenyl)-1-[(3-ethylphenyl)methylamino]butan-2-ol (PubChem CID 59021873) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is (2R,3S)-3-amino-4-(3-butoxyphenyl)-1-[(3-ethylphenyl)methylamino]butan-2-ol.
| Compound Name | (2R,3S)-3-amino-4-(3-butoxyphenyl)-1-[(3-ethylphenyl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 59021873 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | (2R,3S)-3-amino-4-(3-butoxyphenyl)-1-[(3-ethylphenyl)methylamino]butan-2-ol |
| SMILES | CCCCOc1cccc(C[C@H](N)[C@H](O)CNCc2cccc(CC)c2)c1 |
| InChI | InChI=1S/C23H34N2O2/c1-3-5-12-27-21-11-7-9-19(14-21)15-22(24)23(26)17-25-16-20-10-6-8-18(4-2)13-20/h6-11,13-14,22-23,25-26H,3-5,12,15-17,24H2,1-2H3/t22-,23+/m0/s1 |
| InChIKey | JKDLPIYFUBCTHF-XZOQPEGZSA-N |
| XLogP | 3.45 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|