C15H18N2O4 — CID 103103830
N-(2-amino-2-oxoethyl)-N-ethyl-3-(3-hydroxyprop-1-ynyl)-4-methoxybenzamide (PubChem CID 103103830) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-ethyl-3-(3-hydroxyprop-1-ynyl)-4-methoxybenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-ethyl-3-(3-hydroxyprop-1-ynyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 103103830 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-ethyl-3-(3-hydroxyprop-1-ynyl)-4-methoxybenzamide |
| SMILES | CCN(CC(N)=O)C(=O)c1ccc(OC)c(C#CCO)c1 |
| InChI | InChI=1S/C15H18N2O4/c1-3-17(10-14(16)19)15(20)12-6-7-13(21-2)11(9-12)5-4-8-18/h6-7,9,18H,3,8,10H2,1-2H3,(H2,16,19) |
| InChIKey | XHNOPMJHJXAWAP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|