C15H19NO5 — CID 61233776
N,N-bis(2-hydroxyethyl)-3-(3-hydroxyprop-1-ynyl)-4-methoxybenzamide (PubChem CID 61233776) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-3-(3-hydroxyprop-1-ynyl)-4-methoxybenzamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-3-(3-hydroxyprop-1-ynyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 61233776 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-3-(3-hydroxyprop-1-ynyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N(CCO)CCO)cc1C#CCO |
| InChI | InChI=1S/C15H19NO5/c1-21-14-5-4-13(11-12(14)3-2-8-17)15(20)16(6-9-18)7-10-19/h4-5,11,17-19H,6-10H2,1H3 |
| InChIKey | MMWWVKKNZWTXPI-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|