C11H11NO3 — CID 61034076
3-(3-hydroxyprop-1-ynyl)-4-methoxybenzamide (PubChem CID 61034076) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)-4-methoxybenzamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 61034076 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)cc1C#CCO |
| InChI | InChI=1S/C11H11NO3/c1-15-10-5-4-9(11(12)14)7-8(10)3-2-6-13/h4-5,7,13H,6H2,1H3,(H2,12,14) |
| InChIKey | CSGOVWFPYZYJKA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|