C9H13BrN2O3S2 — CID 103103884
2-[(5-bromo-2-methylthiophen-3-yl)sulfonyl-ethylamino]acetamide (PubChem CID 103103884) has the molecular formula C9H13BrN2O3S2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 2-[(5-bromo-2-methylthiophen-3-yl)sulfonyl-ethylamino]acetamide.
| Compound Name | 2-[(5-bromo-2-methylthiophen-3-yl)sulfonyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 103103884 |
| Molecular Formula | C9H13BrN2O3S2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 2-[(5-bromo-2-methylthiophen-3-yl)sulfonyl-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)S(=O)(=O)c1cc(Br)sc1C |
| InChI | InChI=1S/C9H13BrN2O3S2/c1-3-12(5-9(11)13)17(14,15)7-4-8(10)16-6(7)2/h4H,3,5H2,1-2H3,(H2,11,13) |
| InChIKey | FTQOHTVZPDEMES-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |