C11H17N5O4 — CID 103104813
ethyl 5-methyl-1-[3-(methylcarbamoylamino)-3-oxopropyl]triazole-4-carboxylate (PubChem CID 103104813) has the molecular formula C11H17N5O4 and a molecular weight of 283.29 g/mol. Its IUPAC name is ethyl 5-methyl-1-[3-(methylcarbamoylamino)-3-oxopropyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-1-[3-(methylcarbamoylamino)-3-oxopropyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103104813 |
| Molecular Formula | C11H17N5O4 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | ethyl 5-methyl-1-[3-(methylcarbamoylamino)-3-oxopropyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(CCC(=O)NC(=O)NC)c1C |
| InChI | InChI=1S/C11H17N5O4/c1-4-20-10(18)9-7(2)16(15-14-9)6-5-8(17)13-11(19)12-3/h4-6H2,1-3H3,(H2,12,13,17,19) |
| InChIKey | UBERYAVJONMECM-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |