C12H17N5O4 — CID 103114050
prop-2-enyl 5-methyl-1-[3-(methylcarbamoylamino)-3-oxopropyl]triazole-4-carboxylate (PubChem CID 103114050) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is prop-2-enyl 5-methyl-1-[3-(methylcarbamoylamino)-3-oxopropyl]triazole-4-carboxylate.
| Compound Name | prop-2-enyl 5-methyl-1-[3-(methylcarbamoylamino)-3-oxopropyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103114050 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | prop-2-enyl 5-methyl-1-[3-(methylcarbamoylamino)-3-oxopropyl]triazole-4-carboxylate |
| SMILES | C=CCOC(=O)c1nnn(CCC(=O)NC(=O)NC)c1C |
| InChI | InChI=1S/C12H17N5O4/c1-4-7-21-11(19)10-8(2)17(16-15-10)6-5-9(18)14-12(20)13-3/h4H,1,5-7H2,2-3H3,(H2,13,14,18,20) |
| InChIKey | DJKVYCOADOMKLL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|