C22H19F6N3O — CID 10310575
(E,2R,3S)-2-(2,4-difluorophenyl)-6-[2-fluoro-4-(trifluoromethyl)phenyl]-3-methyl-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol (PubChem CID 10310575) has the molecular formula C22H19F6N3O and a molecular weight of 455.40 g/mol. Its IUPAC name is (E,2R,3S)-2-(2,4-difluorophenyl)-6-[2-fluoro-4-(trifluoromethyl)phenyl]-3-methyl-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol.
| Compound Name | (E,2R,3S)-2-(2,4-difluorophenyl)-6-[2-fluoro-4-(trifluoromethyl)phenyl]-3-methyl-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 10310575 |
| Molecular Formula | C22H19F6N3O |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (E,2R,3S)-2-(2,4-difluorophenyl)-6-[2-fluoro-4-(trifluoromethyl)phenyl]-3-methyl-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol |
| SMILES | C[C@@H](C/C=C/c1ccc(C(F)(F)F)cc1F)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H19F6N3O/c1-14(3-2-4-15-5-6-16(9-19(15)24)22(26,27)28)21(32,11-31-13-29-12-30-31)18-8-7-17(23)10-20(18)25/h2,4-10,12-14,32H,3,11H2,1H3/b4-2+/t14-,21+/m0/s1 |
| InChIKey | XLUBKDVXVPVIFP-MBGJOGJLSA-N |
| XLogP | 5.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |