C25H30N6O4 — CID 10310972
N-hydroxy-2-[4-[[5-[4-(morpholin-4-ylmethyl)phenyl]furan-2-yl]methyl]piperazin-1-yl]pyrimidine-5-carboxamide (PubChem CID 10310972) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-hydroxy-2-[4-[[5-[4-(morpholin-4-ylmethyl)phenyl]furan-2-yl]methyl]piperazin-1-yl]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[4-[[5-[4-(morpholin-4-ylmethyl)phenyl]furan-2-yl]methyl]piperazin-1-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 10310972 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | N-hydroxy-2-[4-[[5-[4-(morpholin-4-ylmethyl)phenyl]furan-2-yl]methyl]piperazin-1-yl]pyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCN(Cc3ccc(-c4ccc(CN5CCOCC5)cc4)o3)CC2)nc1 |
| InChI | InChI=1S/C25H30N6O4/c32-24(28-33)21-15-26-25(27-16-21)31-9-7-29(8-10-31)18-22-5-6-23(35-22)20-3-1-19(2-4-20)17-30-11-13-34-14-12-30/h1-6,15-16,33H,7-14,17-18H2,(H,28,32) |
| InChIKey | RNSVGRSSOGNOGL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|