C23H29ClN6O3 — CID 58896200
2-[4-[(E)-4-(4-chlorophenyl)-1-morpholin-4-ylbut-3-en-2-yl]piperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 58896200) has the molecular formula C23H29ClN6O3 and a molecular weight of 472.98 g/mol. Its IUPAC name is 2-[4-[(E)-4-(4-chlorophenyl)-1-morpholin-4-ylbut-3-en-2-yl]piperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[4-[(E)-4-(4-chlorophenyl)-1-morpholin-4-ylbut-3-en-2-yl]piperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 58896200 |
| Molecular Formula | C23H29ClN6O3 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 2-[4-[(E)-4-(4-chlorophenyl)-1-morpholin-4-ylbut-3-en-2-yl]piperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCN(C(/C=C/c3ccc(Cl)cc3)CN3CCOCC3)CC2)nc1 |
| InChI | InChI=1S/C23H29ClN6O3/c24-20-4-1-18(2-5-20)3-6-21(17-28-11-13-33-14-12-28)29-7-9-30(10-8-29)23-25-15-19(16-26-23)22(31)27-32/h1-6,15-16,21,32H,7-14,17H2,(H,27,31)/b6-3+ |
| InChIKey | GSKGXHBTKNHUFJ-ZZXKWVIFSA-N |
| XLogP | 1.79 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|