C24H31N5O4 — CID 76789333
2-[4-(1-hydroxy-4-phenylbut-3-en-2-yl)piperazin-1-yl]-N-(oxan-2-yloxy)pyrimidine-5-carboxamide (PubChem CID 76789333) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 2-[4-(1-hydroxy-4-phenylbut-3-en-2-yl)piperazin-1-yl]-N-(oxan-2-yloxy)pyrimidine-5-carboxamide.
| Compound Name | 2-[4-(1-hydroxy-4-phenylbut-3-en-2-yl)piperazin-1-yl]-N-(oxan-2-yloxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 76789333 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 2-[4-(1-hydroxy-4-phenylbut-3-en-2-yl)piperazin-1-yl]-N-(oxan-2-yloxy)pyrimidine-5-carboxamide |
| SMILES | O=C(NOC1CCCCO1)c1cnc(N2CCN(C(C=Cc3ccccc3)CO)CC2)nc1 |
| InChI | InChI=1S/C24H31N5O4/c30-18-21(10-9-19-6-2-1-3-7-19)28-11-13-29(14-12-28)24-25-16-20(17-26-24)23(31)27-33-22-8-4-5-15-32-22/h1-3,6-7,9-10,16-17,21-22,30H,4-5,8,11-15,18H2,(H,27,31) |
| InChIKey | WTRCYVPAFSLHRA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|