C22H28N4O2S — CID 143172385
S-ethyl 2-[4-[(E)-1-methoxy-4-phenylbut-3-en-2-yl]piperazin-1-yl]pyrimidine-5-carbothioate (PubChem CID 143172385) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is S-ethyl 2-[4-[(E)-1-methoxy-4-phenylbut-3-en-2-yl]piperazin-1-yl]pyrimidine-5-carbothioate.
| Compound Name | S-ethyl 2-[4-[(E)-1-methoxy-4-phenylbut-3-en-2-yl]piperazin-1-yl]pyrimidine-5-carbothioate |
|---|---|
| PubChem CID | 143172385 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | S-ethyl 2-[4-[(E)-1-methoxy-4-phenylbut-3-en-2-yl]piperazin-1-yl]pyrimidine-5-carbothioate |
| SMILES | CCSC(=O)c1cnc(N2CCN(C(/C=C/c3ccccc3)COC)CC2)nc1 |
| InChI | InChI=1S/C22H28N4O2S/c1-3-29-21(27)19-15-23-22(24-16-19)26-13-11-25(12-14-26)20(17-28-2)10-9-18-7-5-4-6-8-18/h4-10,15-16,20H,3,11-14,17H2,1-2H3/b10-9+ |
| InChIKey | XUKHGUDHGJYMAA-MDZDMXLPSA-N |
| XLogP | 3.22 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|