C21H27N5O — CID 143172366
N-[1-[2-[4-[(E)-1-phenylpent-1-en-3-yl]piperazin-1-yl]pyrimidin-5-yl]ethenyl]hydroxylamine (PubChem CID 143172366) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[1-[2-[4-[(E)-1-phenylpent-1-en-3-yl]piperazin-1-yl]pyrimidin-5-yl]ethenyl]hydroxylamine.
| Compound Name | N-[1-[2-[4-[(E)-1-phenylpent-1-en-3-yl]piperazin-1-yl]pyrimidin-5-yl]ethenyl]hydroxylamine |
|---|---|
| PubChem CID | 143172366 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-[1-[2-[4-[(E)-1-phenylpent-1-en-3-yl]piperazin-1-yl]pyrimidin-5-yl]ethenyl]hydroxylamine |
| SMILES | C=C(NO)c1cnc(N2CCN(C(/C=C/c3ccccc3)CC)CC2)nc1 |
| InChI | InChI=1S/C21H27N5O/c1-3-20(10-9-18-7-5-4-6-8-18)25-11-13-26(14-12-25)21-22-15-19(16-23-21)17(2)24-27/h4-10,15-16,20,24,27H,2-3,11-14H2,1H3/b10-9+ |
| InChIKey | SEPURZPXANKBFY-MDZDMXLPSA-N |
| XLogP | 3.04 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|