C33H29N3O4 — CID 10311700
2-[(3-cyanophenyl)methyl-[[4-[3-(3-phenylpropylcarbamoyl)phenyl]phenyl]methyl]amino]-2-oxoacetic acid (PubChem CID 10311700) has the molecular formula C33H29N3O4 and a molecular weight of 531.61 g/mol. Its IUPAC name is 2-[(3-cyanophenyl)methyl-[[4-[3-(3-phenylpropylcarbamoyl)phenyl]phenyl]methyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[(3-cyanophenyl)methyl-[[4-[3-(3-phenylpropylcarbamoyl)phenyl]phenyl]methyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 10311700 |
| Molecular Formula | C33H29N3O4 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 2-[(3-cyanophenyl)methyl-[[4-[3-(3-phenylpropylcarbamoyl)phenyl]phenyl]methyl]amino]-2-oxoacetic acid |
| SMILES | N#Cc1cccc(CN(Cc2ccc(-c3cccc(C(=O)NCCCc4ccccc4)c3)cc2)C(=O)C(=O)O)c1 |
| InChI | InChI=1S/C33H29N3O4/c34-21-26-9-4-10-27(19-26)23-36(32(38)33(39)40)22-25-14-16-28(17-15-25)29-12-5-13-30(20-29)31(37)35-18-6-11-24-7-2-1-3-8-24/h1-5,7-10,12-17,19-20H,6,11,18,22-23H2,(H,35,37)(H,39,40) |
| InChIKey | OKLKZPMMEUTLRC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|