C11H11N5S — CID 103119827
2-methyl-5-(1-methylindazol-3-yl)-1H-1,2,4-triazole-3-thione (PubChem CID 103119827) has the molecular formula C11H11N5S and a molecular weight of 245.31 g/mol. Its IUPAC name is 2-methyl-5-(1-methylindazol-3-yl)-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-methyl-5-(1-methylindazol-3-yl)-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 103119827 |
| Molecular Formula | C11H11N5S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-methyl-5-(1-methylindazol-3-yl)-1H-1,2,4-triazole-3-thione |
| SMILES | Cn1[nH]c(-c2nn(C)c3ccccc23)nc1=S |
| InChI | InChI=1S/C11H11N5S/c1-15-8-6-4-3-5-7(8)9(13-15)10-12-11(17)16(2)14-10/h3-6H,1-2H3,(H,12,14,17) |
| InChIKey | URCODYCFBRHVAJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|