C10H7IN4S — CID 103130052
3-iodo-5-(1-methylindazol-3-yl)-1,2,4-thiadiazole (PubChem CID 103130052) has the molecular formula C10H7IN4S and a molecular weight of 342.17 g/mol. Its IUPAC name is 3-iodo-5-(1-methylindazol-3-yl)-1,2,4-thiadiazole.
| Compound Name | 3-iodo-5-(1-methylindazol-3-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 103130052 |
| Molecular Formula | C10H7IN4S |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 341.94 |
| IUPAC Name | 3-iodo-5-(1-methylindazol-3-yl)-1,2,4-thiadiazole |
| SMILES | Cn1nc(-c2nc(I)ns2)c2ccccc21 |
| InChI | InChI=1S/C10H7IN4S/c1-15-7-5-3-2-4-6(7)8(13-15)9-12-10(11)14-16-9/h2-5H,1H3 |
| InChIKey | ZFYJNVDIMMBIKP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|