C13H15N5O — CID 103121101
N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyrazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 103121101) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyrazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyrazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 103121101 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyrazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | O=C(NCC1=CCNCC1)c1cnn2ccncc12 |
| InChI | InChI=1S/C13H15N5O/c19-13(16-7-10-1-3-14-4-2-10)11-8-17-18-6-5-15-9-12(11)18/h1,5-6,8-9,14H,2-4,7H2,(H,16,19) |
| InChIKey | CTBIOMVOUHDRTE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|