C12H14N2O — CID 103125787
3-[2-(2-methylphenyl)ethyl]-1H-imidazol-2-one (PubChem CID 103125787) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-[2-(2-methylphenyl)ethyl]-1H-imidazol-2-one.
| Compound Name | 3-[2-(2-methylphenyl)ethyl]-1H-imidazol-2-one |
|---|---|
| PubChem CID | 103125787 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-[2-(2-methylphenyl)ethyl]-1H-imidazol-2-one |
| SMILES | Cc1ccccc1CCn1cc[nH]c1=O |
| InChI | InChI=1S/C12H14N2O/c1-10-4-2-3-5-11(10)6-8-14-9-7-13-12(14)15/h2-5,7,9H,6,8H2,1H3,(H,13,15) |
| InChIKey | VQBBPYIYRSHJPO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |