C15H18BrN5 — CID 103128186
1-(4-bromo-1-ethylpyrazol-5-yl)-N-methyl-1-(1-methylindazol-3-yl)methanamine (PubChem CID 103128186) has the molecular formula C15H18BrN5 and a molecular weight of 348.25 g/mol. Its IUPAC name is 1-(4-bromo-1-ethylpyrazol-5-yl)-N-methyl-1-(1-methylindazol-3-yl)methanamine.
| Compound Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-N-methyl-1-(1-methylindazol-3-yl)methanamine |
|---|---|
| PubChem CID | 103128186 |
| Molecular Formula | C15H18BrN5 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-N-methyl-1-(1-methylindazol-3-yl)methanamine |
| SMILES | CCn1ncc(Br)c1C(NC)c1nn(C)c2ccccc12 |
| InChI | InChI=1S/C15H18BrN5/c1-4-21-15(11(16)9-18-21)14(17-2)13-10-7-5-6-8-12(10)20(3)19-13/h5-9,14,17H,4H2,1-3H3 |
| InChIKey | RHLIBJBZXDUBME-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |