C11H11N5S — CID 103129456
[pyrazolo[1,5-a]pyrazin-3-yl(thiophen-2-yl)methyl]hydrazine (PubChem CID 103129456) has the molecular formula C11H11N5S and a molecular weight of 245.31 g/mol. Its IUPAC name is [pyrazolo[1,5-a]pyrazin-3-yl(thiophen-2-yl)methyl]hydrazine.
| Compound Name | [pyrazolo[1,5-a]pyrazin-3-yl(thiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 103129456 |
| Molecular Formula | C11H11N5S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | [pyrazolo[1,5-a]pyrazin-3-yl(thiophen-2-yl)methyl]hydrazine |
| SMILES | NNC(c1cccs1)c1cnn2ccncc12 |
| InChI | InChI=1S/C11H11N5S/c12-15-11(10-2-1-5-17-10)8-6-14-16-4-3-13-7-9(8)16/h1-7,11,15H,12H2 |
| InChIKey | OAPPUOVIXZCPDW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|