C16H18N4 — CID 103129509
[(2,5-dimethylphenyl)-pyrazolo[1,5-a]pyridin-3-ylmethyl]hydrazine (PubChem CID 103129509) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is [(2,5-dimethylphenyl)-pyrazolo[1,5-a]pyridin-3-ylmethyl]hydrazine.
| Compound Name | [(2,5-dimethylphenyl)-pyrazolo[1,5-a]pyridin-3-ylmethyl]hydrazine |
|---|---|
| PubChem CID | 103129509 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [(2,5-dimethylphenyl)-pyrazolo[1,5-a]pyridin-3-ylmethyl]hydrazine |
| SMILES | Cc1ccc(C)c(C(NN)c2cnn3ccccc23)c1 |
| InChI | InChI=1S/C16H18N4/c1-11-6-7-12(2)13(9-11)16(19-17)14-10-18-20-8-4-3-5-15(14)20/h3-10,16,19H,17H2,1-2H3 |
| InChIKey | GJLYTGHMGRWBCF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|