C13H14N4S — CID 103129728
[(5-methylthiophen-3-yl)-pyrazolo[1,5-a]pyridin-3-ylmethyl]hydrazine (PubChem CID 103129728) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is [(5-methylthiophen-3-yl)-pyrazolo[1,5-a]pyridin-3-ylmethyl]hydrazine.
| Compound Name | [(5-methylthiophen-3-yl)-pyrazolo[1,5-a]pyridin-3-ylmethyl]hydrazine |
|---|---|
| PubChem CID | 103129728 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | [(5-methylthiophen-3-yl)-pyrazolo[1,5-a]pyridin-3-ylmethyl]hydrazine |
| SMILES | Cc1cc(C(NN)c2cnn3ccccc23)cs1 |
| InChI | InChI=1S/C13H14N4S/c1-9-6-10(8-18-9)13(16-14)11-7-15-17-5-3-2-4-12(11)17/h2-8,13,16H,14H2,1H3 |
| InChIKey | CJVYYOUALXUDAF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|