C11H16N4S — CID 105313281
[(1,5-dimethylpyrazol-4-yl)-(5-methylthiophen-3-yl)methyl]hydrazine (PubChem CID 105313281) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is [(1,5-dimethylpyrazol-4-yl)-(5-methylthiophen-3-yl)methyl]hydrazine.
| Compound Name | [(1,5-dimethylpyrazol-4-yl)-(5-methylthiophen-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105313281 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | [(1,5-dimethylpyrazol-4-yl)-(5-methylthiophen-3-yl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)c2cnn(C)c2C)cs1 |
| InChI | InChI=1S/C11H16N4S/c1-7-4-9(6-16-7)11(14-12)10-5-13-15(3)8(10)2/h4-6,11,14H,12H2,1-3H3 |
| InChIKey | FDOPUEMLCFGMTF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|