C6H5IN4S — CID 103130050
3-iodo-5-(1-methylpyrazol-3-yl)-1,2,4-thiadiazole (PubChem CID 103130050) has the molecular formula C6H5IN4S and a molecular weight of 292.11 g/mol. Its IUPAC name is 3-iodo-5-(1-methylpyrazol-3-yl)-1,2,4-thiadiazole.
| Compound Name | 3-iodo-5-(1-methylpyrazol-3-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 103130050 |
| Molecular Formula | C6H5IN4S |
| Molecular Weight | 292.11 g/mol |
| Exact Mass | 291.93 |
| IUPAC Name | 3-iodo-5-(1-methylpyrazol-3-yl)-1,2,4-thiadiazole |
| SMILES | Cn1ccc(-c2nc(I)ns2)n1 |
| InChI | InChI=1S/C6H5IN4S/c1-11-3-2-4(9-11)5-8-6(7)10-12-5/h2-3H,1H3 |
| InChIKey | RZTYLZPZGHNNJY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.11 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|