C8H7N3OS — CID 103130489
(1-methylpyrazol-3-yl)-(1,3-thiazol-5-yl)methanone (PubChem CID 103130489) has the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. Its IUPAC name is (1-methylpyrazol-3-yl)-(1,3-thiazol-5-yl)methanone.
| Compound Name | (1-methylpyrazol-3-yl)-(1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 103130489 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | (1-methylpyrazol-3-yl)-(1,3-thiazol-5-yl)methanone |
| SMILES | Cn1ccc(C(=O)c2cncs2)n1 |
| InChI | InChI=1S/C8H7N3OS/c1-11-3-2-6(10-11)8(12)7-4-9-5-13-7/h2-5H,1H3 |
| InChIKey | VKVIURHBIDKQMH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |