C9H6N2OS — CID 141075221
pyridin-2-yl(1,3-thiazol-5-yl)methanone (PubChem CID 141075221) has the molecular formula C9H6N2OS and a molecular weight of 190.23 g/mol. Its IUPAC name is pyridin-2-yl(1,3-thiazol-5-yl)methanone.
| Compound Name | pyridin-2-yl(1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 141075221 |
| Molecular Formula | C9H6N2OS |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | pyridin-2-yl(1,3-thiazol-5-yl)methanone |
| SMILES | O=C(c1ccccn1)c1cncs1 |
| InChI | InChI=1S/C9H6N2OS/c12-9(8-5-10-6-13-8)7-3-1-2-4-11-7/h1-6H |
| InChIKey | IXBUFWAHWFXUMJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |