C10H8N2O2S — CID 130593048
(2-methoxy-1,3-thiazol-5-yl)-pyridin-2-ylmethanone (PubChem CID 130593048) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is (2-methoxy-1,3-thiazol-5-yl)-pyridin-2-ylmethanone.
| Compound Name | (2-methoxy-1,3-thiazol-5-yl)-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 130593048 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | (2-methoxy-1,3-thiazol-5-yl)-pyridin-2-ylmethanone |
| SMILES | COc1ncc(C(=O)c2ccccn2)s1 |
| InChI | InChI=1S/C10H8N2O2S/c1-14-10-12-6-8(15-10)9(13)7-4-2-3-5-11-7/h2-6H,1H3 |
| InChIKey | OBHZLXAAVLOZAX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |