C9H6INO2S2 — CID 130593330
(3-iodothiophen-2-yl)-(2-methoxy-1,3-thiazol-5-yl)methanone (PubChem CID 130593330) has the molecular formula C9H6INO2S2 and a molecular weight of 351.19 g/mol. Its IUPAC name is (3-iodothiophen-2-yl)-(2-methoxy-1,3-thiazol-5-yl)methanone.
| Compound Name | (3-iodothiophen-2-yl)-(2-methoxy-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 130593330 |
| Molecular Formula | C9H6INO2S2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.89 |
| IUPAC Name | (3-iodothiophen-2-yl)-(2-methoxy-1,3-thiazol-5-yl)methanone |
| SMILES | COc1ncc(C(=O)c2sccc2I)s1 |
| InChI | InChI=1S/C9H6INO2S2/c1-13-9-11-4-6(15-9)7(12)8-5(10)2-3-14-8/h2-4H,1H3 |
| InChIKey | VMUPURGCRUCWRV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|