C9H7IN2OS2 — CID 130576160
3-iodo-N-(5-methyl-1,3-thiazol-2-yl)thiophene-2-carboxamide (PubChem CID 130576160) has the molecular formula C9H7IN2OS2 and a molecular weight of 350.21 g/mol. Its IUPAC name is 3-iodo-N-(5-methyl-1,3-thiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | 3-iodo-N-(5-methyl-1,3-thiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 130576160 |
| Molecular Formula | C9H7IN2OS2 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.90 |
| IUPAC Name | 3-iodo-N-(5-methyl-1,3-thiazol-2-yl)thiophene-2-carboxamide |
| SMILES | Cc1cnc(NC(=O)c2sccc2I)s1 |
| InChI | InChI=1S/C9H7IN2OS2/c1-5-4-11-9(15-5)12-8(13)7-6(10)2-3-14-7/h2-4H,1H3,(H,11,12,13) |
| InChIKey | PAWJRHVAHFKXFO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|