C4H5NO2S — CID 130658802
2-methoxy-1,3-thiazol-5-ol (PubChem CID 130658802) has the molecular formula C4H5NO2S and a molecular weight of 131.16 g/mol. Its IUPAC name is 2-methoxy-1,3-thiazol-5-ol.
| Compound Name | 2-methoxy-1,3-thiazol-5-ol |
|---|---|
| PubChem CID | 130658802 |
| Molecular Formula | C4H5NO2S |
| Molecular Weight | 131.16 g/mol |
| Exact Mass | 131.00 |
| IUPAC Name | 2-methoxy-1,3-thiazol-5-ol |
| SMILES | COc1ncc(O)s1 |
| InChI | InChI=1S/C4H5NO2S/c1-7-4-5-2-3(6)8-4/h2,6H,1H3 |
| InChIKey | SZELVXZYXMIHGU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |