C10H13NOS — CID 164652619
5-(cyclopent-3-en-1-ylmethyl)-2-methoxy-1,3-thiazole (PubChem CID 164652619) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 5-(cyclopent-3-en-1-ylmethyl)-2-methoxy-1,3-thiazole.
| Compound Name | 5-(cyclopent-3-en-1-ylmethyl)-2-methoxy-1,3-thiazole |
|---|---|
| PubChem CID | 164652619 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 5-(cyclopent-3-en-1-ylmethyl)-2-methoxy-1,3-thiazole |
| SMILES | COc1ncc(CC2CC=CC2)s1 |
| InChI | InChI=1S/C10H13NOS/c1-12-10-11-7-9(13-10)6-8-4-2-3-5-8/h2-3,7-8H,4-6H2,1H3 |
| InChIKey | JDMIAYMQKCWMQO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|