C6H10N2O2S — CID 82598709
N-[(2-methoxy-1,3-thiazol-5-yl)methyl]-N-methylhydroxylamine (PubChem CID 82598709) has the molecular formula C6H10N2O2S and a molecular weight of 174.23 g/mol. Its IUPAC name is N-[(2-methoxy-1,3-thiazol-5-yl)methyl]-N-methylhydroxylamine.
| Compound Name | N-[(2-methoxy-1,3-thiazol-5-yl)methyl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 82598709 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | N-[(2-methoxy-1,3-thiazol-5-yl)methyl]-N-methylhydroxylamine |
| SMILES | COc1ncc(CN(C)O)s1 |
| InChI | InChI=1S/C6H10N2O2S/c1-8(9)4-5-3-7-6(10-2)11-5/h3,9H,4H2,1-2H3 |
| InChIKey | XRJFRWCMGOXFIU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|