C7H10N2OS — CID 130979726
methyl 5-ethyl-1,3-thiazole-2-carboximidate (PubChem CID 130979726) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is methyl 5-ethyl-1,3-thiazole-2-carboximidate.
| Compound Name | methyl 5-ethyl-1,3-thiazole-2-carboximidate |
|---|---|
| PubChem CID | 130979726 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | methyl 5-ethyl-1,3-thiazole-2-carboximidate |
| SMILES | [H]/N=C(\OC)c1ncc(CC)s1 |
| InChI | InChI=1S/C7H10N2OS/c1-3-5-4-9-7(11-5)6(8)10-2/h4,8H,3H2,1-2H3/b8-6- |
| InChIKey | VCAAMFWGKQLQHO-VURMDHGXSA-N |
| XLogP | 1.68 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|