C6H8ClNOS — CID 130590548
5-(2-chloroethyl)-2-methoxy-1,3-thiazole (PubChem CID 130590548) has the molecular formula C6H8ClNOS and a molecular weight of 177.66 g/mol. Its IUPAC name is 5-(2-chloroethyl)-2-methoxy-1,3-thiazole.
| Compound Name | 5-(2-chloroethyl)-2-methoxy-1,3-thiazole |
|---|---|
| PubChem CID | 130590548 |
| Molecular Formula | C6H8ClNOS |
| Molecular Weight | 177.66 g/mol |
| Exact Mass | 177.00 |
| IUPAC Name | 5-(2-chloroethyl)-2-methoxy-1,3-thiazole |
| SMILES | COc1ncc(CCCl)s1 |
| InChI | InChI=1S/C6H8ClNOS/c1-9-6-8-4-5(10-6)2-3-7/h4H,2-3H2,1H3 |
| InChIKey | QEQKAMLCZICOES-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.66 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|