C13H16N2OS — CID 115091894
3-[2-(2-methoxyphenyl)-1,3-thiazol-5-yl]propan-1-amine (PubChem CID 115091894) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 3-[2-(2-methoxyphenyl)-1,3-thiazol-5-yl]propan-1-amine.
| Compound Name | 3-[2-(2-methoxyphenyl)-1,3-thiazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 115091894 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-[2-(2-methoxyphenyl)-1,3-thiazol-5-yl]propan-1-amine |
| SMILES | COc1ccccc1-c1ncc(CCCN)s1 |
| InChI | InChI=1S/C13H16N2OS/c1-16-12-7-3-2-6-11(12)13-15-9-10(17-13)5-4-8-14/h2-3,6-7,9H,4-5,8,14H2,1H3 |
| InChIKey | OABKHRPCDMGKMN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |