About tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid
tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid (PubChem CID 158791708) has the molecular formula C13H15ClN2O5S2
and a molecular weight of 378.86 g/mol. Its IUPAC name is tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 158791708 |
| Molecular Formula | C13H15ClN2O5S2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)c1cnc(Cl)s1.COc1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C8H10ClNO2S.C5H5NO3S/c1-8(2,3)12-6(11)5-4-10-7(9)13-5;1-9-5-6-2-3(10-5)4(7)8/h4H,1-3H3;2H,1H3,(H,7,8) |
| InChIKey | ISIYAPRABOVZKJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid?
The IUPAC name of tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid (CID 158791708) is tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid is CC(C)(C)OC(=O)c1cnc(Cl)s1.COc1ncc(C(=O)O)s1.
What is the InChIKey of tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid?
The InChIKey is ISIYAPRABOVZKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO2S.C5H5NO3S/c1-8(2,3)12-6(11)5-4-10-7(9)13-5;1-9-5-6-2-3(10-5)4(7)8/h4H,1-3H3;2H,1H3,(H,7,8).
What are the key properties of tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid?
tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid has a molecular weight of 378.86 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-chloro-1,3-thiazole-5-carboxylate;2-methoxy-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 158791708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).