About 2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid
2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid (PubChem CID 141374832) has the molecular formula C6H4F3NO3S
and a molecular weight of 227.16 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid.
Analyze 2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid (CID 141374832) is 2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(OCC(F)(F)F)s1.
What is the InChIKey of 2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid?
The InChIKey is HHZQNTKEEYLMHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NO3S/c7-6(8,9)2-13-5-10-1-3(14-5)4(11)12/h1H,2H2,(H,11,12).
What are the key properties of 2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid?
2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid has a molecular weight of 227.16 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 141374832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).