C10H16FN3 — CID 103132870
3-[fluoro-(1-methylpyrazol-3-yl)methyl]piperidine (PubChem CID 103132870) has the molecular formula C10H16FN3 and a molecular weight of 197.26 g/mol. Its IUPAC name is 3-[fluoro-(1-methylpyrazol-3-yl)methyl]piperidine.
| Compound Name | 3-[fluoro-(1-methylpyrazol-3-yl)methyl]piperidine |
|---|---|
| PubChem CID | 103132870 |
| Molecular Formula | C10H16FN3 |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 3-[fluoro-(1-methylpyrazol-3-yl)methyl]piperidine |
| SMILES | Cn1ccc(C(F)C2CCCNC2)n1 |
| InChI | InChI=1S/C10H16FN3/c1-14-6-4-9(13-14)10(11)8-3-2-5-12-7-8/h4,6,8,10,12H,2-3,5,7H2,1H3 |
| InChIKey | JNVQKTIEHUFCQR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |