C11H16FN3 — CID 112565468
3-[fluoro(piperidin-3-yl)methyl]pyridin-4-amine (PubChem CID 112565468) has the molecular formula C11H16FN3 and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-[fluoro(piperidin-3-yl)methyl]pyridin-4-amine.
| Compound Name | 3-[fluoro(piperidin-3-yl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 112565468 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 3-[fluoro(piperidin-3-yl)methyl]pyridin-4-amine |
| SMILES | Nc1ccncc1C(F)C1CCCNC1 |
| InChI | InChI=1S/C11H16FN3/c12-11(8-2-1-4-14-6-8)9-7-15-5-3-10(9)13/h3,5,7-8,11,14H,1-2,4,6H2,(H2,13,15) |
| InChIKey | ZFJUQLPGBQJRHO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |