C14H27N3OS — CID 103134287
2-methyl-2-[4-[(5-methyloxolan-2-yl)methyl]piperazin-1-yl]propanethioamide (PubChem CID 103134287) has the molecular formula C14H27N3OS and a molecular weight of 285.46 g/mol. Its IUPAC name is 2-methyl-2-[4-[(5-methyloxolan-2-yl)methyl]piperazin-1-yl]propanethioamide.
| Compound Name | 2-methyl-2-[4-[(5-methyloxolan-2-yl)methyl]piperazin-1-yl]propanethioamide |
|---|---|
| PubChem CID | 103134287 |
| Molecular Formula | C14H27N3OS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 2-methyl-2-[4-[(5-methyloxolan-2-yl)methyl]piperazin-1-yl]propanethioamide |
| SMILES | CC1CCC(CN2CCN(C(C)(C)C(N)=S)CC2)O1 |
| InChI | InChI=1S/C14H27N3OS/c1-11-4-5-12(18-11)10-16-6-8-17(9-7-16)14(2,3)13(15)19/h11-12H,4-10H2,1-3H3,(H2,15,19) |
| InChIKey | PFOTWWDMOZMSSO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|