C14H13BrFNO3 — CID 103135050
7-bromo-5-fluoro-1-[(5-methyloxolan-2-yl)methyl]indole-2,3-dione (PubChem CID 103135050) has the molecular formula C14H13BrFNO3 and a molecular weight of 342.16 g/mol. Its IUPAC name is 7-bromo-5-fluoro-1-[(5-methyloxolan-2-yl)methyl]indole-2,3-dione.
| Compound Name | 7-bromo-5-fluoro-1-[(5-methyloxolan-2-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 103135050 |
| Molecular Formula | C14H13BrFNO3 |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 7-bromo-5-fluoro-1-[(5-methyloxolan-2-yl)methyl]indole-2,3-dione |
| SMILES | CC1CCC(CN2C(=O)C(=O)c3cc(F)cc(Br)c32)O1 |
| InChI | InChI=1S/C14H13BrFNO3/c1-7-2-3-9(20-7)6-17-12-10(13(18)14(17)19)4-8(16)5-11(12)15/h4-5,7,9H,2-3,6H2,1H3 |
| InChIKey | GMCSQVUVYFZWDF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|