C15H21ClO — CID 103142699
2-[3-chloro-2-(4-methylphenyl)propyl]-5-methyloxolane (PubChem CID 103142699) has the molecular formula C15H21ClO and a molecular weight of 252.78 g/mol. Its IUPAC name is 2-[3-chloro-2-(4-methylphenyl)propyl]-5-methyloxolane.
| Compound Name | 2-[3-chloro-2-(4-methylphenyl)propyl]-5-methyloxolane |
|---|---|
| PubChem CID | 103142699 |
| Molecular Formula | C15H21ClO |
| Molecular Weight | 252.78 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-[3-chloro-2-(4-methylphenyl)propyl]-5-methyloxolane |
| SMILES | Cc1ccc(C(CCl)CC2CCC(C)O2)cc1 |
| InChI | InChI=1S/C15H21ClO/c1-11-3-6-13(7-4-11)14(10-16)9-15-8-5-12(2)17-15/h3-4,6-7,12,14-15H,5,8-10H2,1-2H3 |
| InChIKey | CDKUKOVTEIATIJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.78 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|