C18H19ClO — CID 79435863
2-[3-chloro-2-(4-methylphenyl)propyl]-2,3-dihydro-1-benzofuran (PubChem CID 79435863) has the molecular formula C18H19ClO and a molecular weight of 286.80 g/mol. Its IUPAC name is 2-[3-chloro-2-(4-methylphenyl)propyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 2-[3-chloro-2-(4-methylphenyl)propyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 79435863 |
| Molecular Formula | C18H19ClO |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-[3-chloro-2-(4-methylphenyl)propyl]-2,3-dihydro-1-benzofuran |
| SMILES | Cc1ccc(C(CCl)CC2Cc3ccccc3O2)cc1 |
| InChI | InChI=1S/C18H19ClO/c1-13-6-8-14(9-7-13)16(12-19)11-17-10-15-4-2-3-5-18(15)20-17/h2-9,16-17H,10-12H2,1H3 |
| InChIKey | CYBGJZDQYOFXQU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|