C17H16Cl2O — CID 79433736
2-[3-chloro-2-(3-chlorophenyl)propyl]-2,3-dihydro-1-benzofuran (PubChem CID 79433736) has the molecular formula C17H16Cl2O and a molecular weight of 307.22 g/mol. Its IUPAC name is 2-[3-chloro-2-(3-chlorophenyl)propyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 2-[3-chloro-2-(3-chlorophenyl)propyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 79433736 |
| Molecular Formula | C17H16Cl2O |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-[3-chloro-2-(3-chlorophenyl)propyl]-2,3-dihydro-1-benzofuran |
| SMILES | ClCC(CC1Cc2ccccc2O1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2O/c18-11-14(12-5-3-6-15(19)8-12)10-16-9-13-4-1-2-7-17(13)20-16/h1-8,14,16H,9-11H2 |
| InChIKey | LVICNBLZHUIJTB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|