C18H16N2 — CID 103143198
2-isoquinolin-8-yl-1,3-dihydroinden-2-amine (PubChem CID 103143198) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-isoquinolin-8-yl-1,3-dihydroinden-2-amine.
| Compound Name | 2-isoquinolin-8-yl-1,3-dihydroinden-2-amine |
|---|---|
| PubChem CID | 103143198 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-isoquinolin-8-yl-1,3-dihydroinden-2-amine |
| SMILES | NC1(c2cccc3ccncc23)Cc2ccccc2C1 |
| InChI | InChI=1S/C18H16N2/c19-18(10-14-4-1-2-5-15(14)11-18)17-7-3-6-13-8-9-20-12-16(13)17/h1-9,12H,10-11,19H2 |
| InChIKey | NQKOUZRXCKHOFM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |