C17H22N2 — CID 64752040
1-isoquinolin-5-yl-3,5-dimethylcyclohexan-1-amine (PubChem CID 64752040) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 1-isoquinolin-5-yl-3,5-dimethylcyclohexan-1-amine.
| Compound Name | 1-isoquinolin-5-yl-3,5-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64752040 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 1-isoquinolin-5-yl-3,5-dimethylcyclohexan-1-amine |
| SMILES | CC1CC(C)CC(N)(c2cccc3cnccc23)C1 |
| InChI | InChI=1S/C17H22N2/c1-12-8-13(2)10-17(18,9-12)16-5-3-4-14-11-19-7-6-15(14)16/h3-7,11-13H,8-10,18H2,1-2H3 |
| InChIKey | FRKCTRXVWGWQMO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |