C15H12F3N — CID 103144140
8-(2,4,5-trifluorophenyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 103144140) has the molecular formula C15H12F3N and a molecular weight of 263.26 g/mol. Its IUPAC name is 8-(2,4,5-trifluorophenyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 8-(2,4,5-trifluorophenyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 103144140 |
| Molecular Formula | C15H12F3N |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 8-(2,4,5-trifluorophenyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Fc1cc(F)c(-c2cccc3c2CNCC3)cc1F |
| InChI | InChI=1S/C15H12F3N/c16-13-7-15(18)14(17)6-11(13)10-3-1-2-9-4-5-19-8-12(9)10/h1-3,6-7,19H,4-5,8H2 |
| InChIKey | UCGCCYCPNUJCIE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|