C8H10ClF3N2O2 — CID 103145863
5-(1-chloroethyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazole (PubChem CID 103145863) has the molecular formula C8H10ClF3N2O2 and a molecular weight of 258.63 g/mol. Its IUPAC name is 5-(1-chloroethyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazole.
| Compound Name | 5-(1-chloroethyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103145863 |
| Molecular Formula | C8H10ClF3N2O2 |
| Molecular Weight | 258.63 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 5-(1-chloroethyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-oxadiazole |
| SMILES | CC(Cl)c1nc(CCOCC(F)(F)F)no1 |
| InChI | InChI=1S/C8H10ClF3N2O2/c1-5(9)7-13-6(14-16-7)2-3-15-4-8(10,11)12/h5H,2-4H2,1H3 |
| InChIKey | JJTRLHBZPXCMBQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|